C25H27ClN2O — CID 17054412
2-(1H-indol-3-yl)-N-[[4-[(4-methylphenyl)methoxy]phenyl]methyl]ethanamine;hydrochloride (PubChem CID 17054412) has the molecular formula C25H27ClN2O and a molecular weight of 406.96 g/mol. Its IUPAC name is 2-(1H-indol-3-yl)-N-[[4-[(4-methylphenyl)methoxy]phenyl]methyl]ethanamine;hydrochloride.
| Compound Name | 2-(1H-indol-3-yl)-N-[[4-[(4-methylphenyl)methoxy]phenyl]methyl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 17054412 |
| Molecular Formula | C25H27ClN2O |
| Molecular Weight | 406.96 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | 2-(1H-indol-3-yl)-N-[[4-[(4-methylphenyl)methoxy]phenyl]methyl]ethanamine;hydrochloride |
| SMILES | Cc1ccc(COc2ccc(CNCCc3c[nH]c4ccccc34)cc2)cc1.Cl |
| InChI | InChI=1S/C25H26N2O.ClH/c1-19-6-8-21(9-7-19)18-28-23-12-10-20(11-13-23)16-26-15-14-22-17-27-25-5-3-2-4-24(22)25;/h2-13,17,26-27H,14-16,18H2,1H3;1H |
| InChIKey | WNSMFDWFTHKLEX-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 37.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.96 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|