C26H23ClF5N2O3S+ — CID 59526596
2-[1-(3-chlorophenyl)sulfonyl-6-fluoroindol-3-yl]ethyl-[[3-(2,2,3,3-tetrafluoropropoxy)phenyl]methyl]azanium (PubChem CID 59526596) has the molecular formula C26H23ClF5N2O3S+ and a molecular weight of 573.99 g/mol. Its IUPAC name is 2-[1-(3-chlorophenyl)sulfonyl-6-fluoroindol-3-yl]ethyl-[[3-(2,2,3,3-tetrafluoropropoxy)phenyl]methyl]azanium.
| Compound Name | 2-[1-(3-chlorophenyl)sulfonyl-6-fluoroindol-3-yl]ethyl-[[3-(2,2,3,3-tetrafluoropropoxy)phenyl]methyl]azanium |
|---|---|
| PubChem CID | 59526596 |
| Molecular Formula | C26H23ClF5N2O3S+ |
| Molecular Weight | 573.99 g/mol |
| Exact Mass | 573.10 |
| IUPAC Name | 2-[1-(3-chlorophenyl)sulfonyl-6-fluoroindol-3-yl]ethyl-[[3-(2,2,3,3-tetrafluoropropoxy)phenyl]methyl]azanium |
| SMILES | O=S(=O)(c1cccc(Cl)c1)n1cc(CC[NH2+]Cc2cccc(OCC(F)(F)C(F)F)c2)c2ccc(F)cc21 |
| InChI | InChI=1S/C26H22ClF5N2O3S/c27-19-4-2-6-22(12-19)38(35,36)34-15-18(23-8-7-20(28)13-24(23)34)9-10-33-14-17-3-1-5-21(11-17)37-16-26(31,32)25(29)30/h1-8,11-13,15,25,33H,9-10,14,16H2/p+1 |
| InChIKey | MAEUEYHUXSZIBV-UHFFFAOYSA-O |
| XLogP | 5.26 |
| TPSA | 64.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.99 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|