C20H18F4N2O — CID 131986451
2-(6-fluoro-1H-indol-3-yl)-N-[[3-[(E)-2,3,3-trifluoroprop-1-enoxy]phenyl]methyl]ethanamine (PubChem CID 131986451) has the molecular formula C20H18F4N2O and a molecular weight of 378.37 g/mol. Its IUPAC name is 2-(6-fluoro-1H-indol-3-yl)-N-[[3-[(E)-2,3,3-trifluoroprop-1-enoxy]phenyl]methyl]ethanamine.
| Compound Name | 2-(6-fluoro-1H-indol-3-yl)-N-[[3-[(E)-2,3,3-trifluoroprop-1-enoxy]phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 131986451 |
| Molecular Formula | C20H18F4N2O |
| Molecular Weight | 378.37 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 2-(6-fluoro-1H-indol-3-yl)-N-[[3-[(E)-2,3,3-trifluoroprop-1-enoxy]phenyl]methyl]ethanamine |
| SMILES | F/C(=C/Oc1cccc(CNCCc2c[nH]c3cc(F)ccc23)c1)C(F)F |
| InChI | InChI=1S/C20H18F4N2O/c21-15-4-5-17-14(11-26-19(17)9-15)6-7-25-10-13-2-1-3-16(8-13)27-12-18(22)20(23)24/h1-5,8-9,11-12,20,25-26H,6-7,10H2/b18-12+ |
| InChIKey | TVCZRSNVWYMXMJ-LDADJPATSA-N |
| XLogP | 5.09 |
| TPSA | 37.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.37 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|