C22H20FN3 — CID 151189030
2-(7-fluoro-1H-indol-3-yl)-N-[(3-pyridin-4-ylphenyl)methyl]ethanamine (PubChem CID 151189030) has the molecular formula C22H20FN3 and a molecular weight of 345.42 g/mol. Its IUPAC name is 2-(7-fluoro-1H-indol-3-yl)-N-[(3-pyridin-4-ylphenyl)methyl]ethanamine.
| Compound Name | 2-(7-fluoro-1H-indol-3-yl)-N-[(3-pyridin-4-ylphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 151189030 |
| Molecular Formula | C22H20FN3 |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 2-(7-fluoro-1H-indol-3-yl)-N-[(3-pyridin-4-ylphenyl)methyl]ethanamine |
| SMILES | Fc1cccc2c(CCNCc3cccc(-c4ccncc4)c3)c[nH]c12 |
| InChI | InChI=1S/C22H20FN3/c23-21-6-2-5-20-19(15-26-22(20)21)9-12-25-14-16-3-1-4-18(13-16)17-7-10-24-11-8-17/h1-8,10-11,13,15,25-26H,9,12,14H2 |
| InChIKey | NFXNQYOFLFBZBR-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|