C15H19FN2 — CID 82498246
N-[2-(7-fluoro-1H-indol-3-yl)ethyl]cyclopentanamine (PubChem CID 82498246) has the molecular formula C15H19FN2 and a molecular weight of 246.33 g/mol. Its IUPAC name is N-[2-(7-fluoro-1H-indol-3-yl)ethyl]cyclopentanamine.
| Compound Name | N-[2-(7-fluoro-1H-indol-3-yl)ethyl]cyclopentanamine |
|---|---|
| PubChem CID | 82498246 |
| Molecular Formula | C15H19FN2 |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | N-[2-(7-fluoro-1H-indol-3-yl)ethyl]cyclopentanamine |
| SMILES | Fc1cccc2c(CCNC3CCCC3)c[nH]c12 |
| InChI | InChI=1S/C15H19FN2/c16-14-7-3-6-13-11(10-18-15(13)14)8-9-17-12-4-1-2-5-12/h3,6-7,10,12,17-18H,1-2,4-5,8-9H2 |
| InChIKey | YTVSMQZOIOXPDW-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |