C21H29N3O2 — CID 56712439
[4-[2-(7-methyl-1H-indol-3-yl)ethylamino]piperidin-1-yl]-(oxolan-2-yl)methanone (PubChem CID 56712439) has the molecular formula C21H29N3O2 and a molecular weight of 355.48 g/mol. Its IUPAC name is [4-[2-(7-methyl-1H-indol-3-yl)ethylamino]piperidin-1-yl]-(oxolan-2-yl)methanone.
| Compound Name | [4-[2-(7-methyl-1H-indol-3-yl)ethylamino]piperidin-1-yl]-(oxolan-2-yl)methanone |
|---|---|
| PubChem CID | 56712439 |
| Molecular Formula | C21H29N3O2 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.23 |
| IUPAC Name | [4-[2-(7-methyl-1H-indol-3-yl)ethylamino]piperidin-1-yl]-(oxolan-2-yl)methanone |
| SMILES | Cc1cccc2c(CCNC3CCN(C(=O)C4CCCO4)CC3)c[nH]c12 |
| InChI | InChI=1S/C21H29N3O2/c1-15-4-2-5-18-16(14-23-20(15)18)7-10-22-17-8-11-24(12-9-17)21(25)19-6-3-13-26-19/h2,4-5,14,17,19,22-23H,3,6-13H2,1H3 |
| InChIKey | FBUYNZXAGBVBNM-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |