C18H23ClN2O5S — CID 18406833
2-amino-N-hydroxy-3,3-dimethyl-4-(4-phenoxyphenyl)sulfonylbutanamide;hydrochloride (PubChem CID 18406833) has the molecular formula C18H23ClN2O5S and a molecular weight of 414.91 g/mol. Its IUPAC name is 2-amino-N-hydroxy-3,3-dimethyl-4-(4-phenoxyphenyl)sulfonylbutanamide;hydrochloride.
| Compound Name | 2-amino-N-hydroxy-3,3-dimethyl-4-(4-phenoxyphenyl)sulfonylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 18406833 |
| Molecular Formula | C18H23ClN2O5S |
| Molecular Weight | 414.91 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | 2-amino-N-hydroxy-3,3-dimethyl-4-(4-phenoxyphenyl)sulfonylbutanamide;hydrochloride |
| SMILES | CC(C)(CS(=O)(=O)c1ccc(Oc2ccccc2)cc1)C(N)C(=O)NO.Cl |
| InChI | InChI=1S/C18H22N2O5S.ClH/c1-18(2,16(19)17(21)20-22)12-26(23,24)15-10-8-14(9-11-15)25-13-6-4-3-5-7-13;/h3-11,16,22H,12,19H2,1-2H3,(H,20,21);1H |
| InChIKey | UMQHAEBCBFCCGD-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.91 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|