C24H24N2O8S — CID 59071627
N-[(2R)-1-(hydroxyamino)-1-oxo-3-(4-phenoxyphenyl)sulfonylpropan-2-yl]-2,6-dimethoxybenzamide (PubChem CID 59071627) has the molecular formula C24H24N2O8S and a molecular weight of 500.53 g/mol. Its IUPAC name is N-[(2R)-1-(hydroxyamino)-1-oxo-3-(4-phenoxyphenyl)sulfonylpropan-2-yl]-2,6-dimethoxybenzamide.
| Compound Name | N-[(2R)-1-(hydroxyamino)-1-oxo-3-(4-phenoxyphenyl)sulfonylpropan-2-yl]-2,6-dimethoxybenzamide |
|---|---|
| PubChem CID | 59071627 |
| Molecular Formula | C24H24N2O8S |
| Molecular Weight | 500.53 g/mol |
| Exact Mass | 500.13 |
| IUPAC Name | N-[(2R)-1-(hydroxyamino)-1-oxo-3-(4-phenoxyphenyl)sulfonylpropan-2-yl]-2,6-dimethoxybenzamide |
| SMILES | COc1cccc(OC)c1C(=O)N[C@@H](CS(=O)(=O)c1ccc(Oc2ccccc2)cc1)C(=O)NO |
| InChI | InChI=1S/C24H24N2O8S/c1-32-20-9-6-10-21(33-2)22(20)24(28)25-19(23(27)26-29)15-35(30,31)18-13-11-17(12-14-18)34-16-7-4-3-5-8-16/h3-14,19,29H,15H2,1-2H3,(H,25,28)(H,26,27)/t19-/m0/s1 |
| InChIKey | MLONDWWDPWNWGR-IBGZPJMESA-N |
| XLogP | 2.57 |
| TPSA | 140.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.53 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|