C22H21N3O5S — CID 142029516
N-[(2R)-3-(4-benzylphenyl)sulfonyl-1-(hydroxyamino)-1-oxopropan-2-yl]pyridine-4-carboxamide (PubChem CID 142029516) has the molecular formula C22H21N3O5S and a molecular weight of 439.49 g/mol. Its IUPAC name is N-[(2R)-3-(4-benzylphenyl)sulfonyl-1-(hydroxyamino)-1-oxopropan-2-yl]pyridine-4-carboxamide.
| Compound Name | N-[(2R)-3-(4-benzylphenyl)sulfonyl-1-(hydroxyamino)-1-oxopropan-2-yl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 142029516 |
| Molecular Formula | C22H21N3O5S |
| Molecular Weight | 439.49 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | N-[(2R)-3-(4-benzylphenyl)sulfonyl-1-(hydroxyamino)-1-oxopropan-2-yl]pyridine-4-carboxamide |
| SMILES | O=C(N[C@@H](CS(=O)(=O)c1ccc(Cc2ccccc2)cc1)C(=O)NO)c1ccncc1 |
| InChI | InChI=1S/C22H21N3O5S/c26-21(18-10-12-23-13-11-18)24-20(22(27)25-28)15-31(29,30)19-8-6-17(7-9-19)14-16-4-2-1-3-5-16/h1-13,20,28H,14-15H2,(H,24,26)(H,25,27)/t20-/m0/s1 |
| InChIKey | WWXKGNXQVSEJSG-FQEVSTJZSA-N |
| XLogP | 1.75 |
| TPSA | 125.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.49 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|