C18H18N4O4S — CID 18381752
N-[3-benzylsulfonyl-1-(cyanomethylamino)-1-oxopropan-2-yl]pyridine-4-carboxamide (PubChem CID 18381752) has the molecular formula C18H18N4O4S and a molecular weight of 386.43 g/mol. Its IUPAC name is N-[3-benzylsulfonyl-1-(cyanomethylamino)-1-oxopropan-2-yl]pyridine-4-carboxamide.
| Compound Name | N-[3-benzylsulfonyl-1-(cyanomethylamino)-1-oxopropan-2-yl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 18381752 |
| Molecular Formula | C18H18N4O4S |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | N-[3-benzylsulfonyl-1-(cyanomethylamino)-1-oxopropan-2-yl]pyridine-4-carboxamide |
| SMILES | N#CCNC(=O)C(CS(=O)(=O)Cc1ccccc1)NC(=O)c1ccncc1 |
| InChI | InChI=1S/C18H18N4O4S/c19-8-11-21-18(24)16(22-17(23)15-6-9-20-10-7-15)13-27(25,26)12-14-4-2-1-3-5-14/h1-7,9-10,16H,11-13H2,(H,21,24)(H,22,23) |
| InChIKey | PHHODGGHWSOOMM-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 129.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|