C19H17FN4O6S — CID 18381824
N-[1-(cyanomethylamino)-3-[(2-fluoro-6-nitrophenyl)methylsulfonyl]-1-oxopropan-2-yl]benzamide (PubChem CID 18381824) has the molecular formula C19H17FN4O6S and a molecular weight of 448.43 g/mol. Its IUPAC name is N-[1-(cyanomethylamino)-3-[(2-fluoro-6-nitrophenyl)methylsulfonyl]-1-oxopropan-2-yl]benzamide.
| Compound Name | N-[1-(cyanomethylamino)-3-[(2-fluoro-6-nitrophenyl)methylsulfonyl]-1-oxopropan-2-yl]benzamide |
|---|---|
| PubChem CID | 18381824 |
| Molecular Formula | C19H17FN4O6S |
| Molecular Weight | 448.43 g/mol |
| Exact Mass | 448.09 |
| IUPAC Name | N-[1-(cyanomethylamino)-3-[(2-fluoro-6-nitrophenyl)methylsulfonyl]-1-oxopropan-2-yl]benzamide |
| SMILES | N#CCNC(=O)C(CS(=O)(=O)Cc1c(F)cccc1[N+](=O)[O-])NC(=O)c1ccccc1 |
| InChI | InChI=1S/C19H17FN4O6S/c20-15-7-4-8-17(24(27)28)14(15)11-31(29,30)12-16(19(26)22-10-9-21)23-18(25)13-5-2-1-3-6-13/h1-8,16H,10-12H2,(H,22,26)(H,23,25) |
| InChIKey | USDFFHDDNRNBST-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 159.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.43 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|