C14H15F2N3O6S — CID 142051589
[(2R)-1-(cyanomethylamino)-3-[[2-(difluoromethoxy)phenyl]methylsulfonyl]-1-oxopropan-2-yl]carbamic acid (PubChem CID 142051589) has the molecular formula C14H15F2N3O6S and a molecular weight of 391.35 g/mol. Its IUPAC name is [(2R)-1-(cyanomethylamino)-3-[[2-(difluoromethoxy)phenyl]methylsulfonyl]-1-oxopropan-2-yl]carbamic acid.
| Compound Name | [(2R)-1-(cyanomethylamino)-3-[[2-(difluoromethoxy)phenyl]methylsulfonyl]-1-oxopropan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 142051589 |
| Molecular Formula | C14H15F2N3O6S |
| Molecular Weight | 391.35 g/mol |
| Exact Mass | 391.06 |
| IUPAC Name | [(2R)-1-(cyanomethylamino)-3-[[2-(difluoromethoxy)phenyl]methylsulfonyl]-1-oxopropan-2-yl]carbamic acid |
| SMILES | N#CCNC(=O)[C@H](CS(=O)(=O)Cc1ccccc1OC(F)F)NC(=O)O |
| InChI | InChI=1S/C14H15F2N3O6S/c15-13(16)25-11-4-2-1-3-9(11)7-26(23,24)8-10(19-14(21)22)12(20)18-6-5-17/h1-4,10,13,19H,6-8H2,(H,18,20)(H,21,22)/t10-/m0/s1 |
| InChIKey | ZGHULSIFMNAANB-JTQLQIEISA-N |
| XLogP | 0.48 |
| TPSA | 145.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.35 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|