C11H13F2NO5S — CID 54111128
2-[[2-(difluoromethoxy)phenyl]methylsulfonyl]ethylcarbamic acid (PubChem CID 54111128) has the molecular formula C11H13F2NO5S and a molecular weight of 309.29 g/mol. Its IUPAC name is 2-[[2-(difluoromethoxy)phenyl]methylsulfonyl]ethylcarbamic acid.
| Compound Name | 2-[[2-(difluoromethoxy)phenyl]methylsulfonyl]ethylcarbamic acid |
|---|---|
| PubChem CID | 54111128 |
| Molecular Formula | C11H13F2NO5S |
| Molecular Weight | 309.29 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | 2-[[2-(difluoromethoxy)phenyl]methylsulfonyl]ethylcarbamic acid |
| SMILES | O=C(O)NCCS(=O)(=O)Cc1ccccc1OC(F)F |
| InChI | InChI=1S/C11H13F2NO5S/c12-10(13)19-9-4-2-1-3-8(9)7-20(17,18)6-5-14-11(15)16/h1-4,10,14H,5-7H2,(H,15,16) |
| InChIKey | NHDWMDCIZCLUFV-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.29 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |