C23H20F2N4O5S — CID 24886582
N-[(2R)-1-[cyano(methyl)amino]-3-[[2-(difluoromethoxy)phenyl]methylsulfonyl]-1-oxopropan-2-yl]quinoline-3-carboxamide (PubChem CID 24886582) has the molecular formula C23H20F2N4O5S and a molecular weight of 502.50 g/mol. Its IUPAC name is N-[(2R)-1-[cyano(methyl)amino]-3-[[2-(difluoromethoxy)phenyl]methylsulfonyl]-1-oxopropan-2-yl]quinoline-3-carboxamide.
| Compound Name | N-[(2R)-1-[cyano(methyl)amino]-3-[[2-(difluoromethoxy)phenyl]methylsulfonyl]-1-oxopropan-2-yl]quinoline-3-carboxamide |
|---|---|
| PubChem CID | 24886582 |
| Molecular Formula | C23H20F2N4O5S |
| Molecular Weight | 502.50 g/mol |
| Exact Mass | 502.11 |
| IUPAC Name | N-[(2R)-1-[cyano(methyl)amino]-3-[[2-(difluoromethoxy)phenyl]methylsulfonyl]-1-oxopropan-2-yl]quinoline-3-carboxamide |
| SMILES | CN(C#N)C(=O)[C@H](CS(=O)(=O)Cc1ccccc1OC(F)F)NC(=O)c1cnc2ccccc2c1 |
| InChI | InChI=1S/C23H20F2N4O5S/c1-29(14-26)22(31)19(28-21(30)17-10-15-6-2-4-8-18(15)27-11-17)13-35(32,33)12-16-7-3-5-9-20(16)34-23(24)25/h2-11,19,23H,12-13H2,1H3,(H,28,30)/t19-/m0/s1 |
| InChIKey | BXNRQOGSWOJVIT-IBGZPJMESA-N |
| XLogP | 2.49 |
| TPSA | 129.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.50 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|