C20H17F4N3O5S — CID 24885867
N-[(2R)-1-[cyano(methyl)amino]-3-[[2-(difluoromethoxy)phenyl]methylsulfonyl]-1-oxopropan-2-yl]-3,4-difluorobenzamide (PubChem CID 24885867) has the molecular formula C20H17F4N3O5S and a molecular weight of 487.43 g/mol. Its IUPAC name is N-[(2R)-1-[cyano(methyl)amino]-3-[[2-(difluoromethoxy)phenyl]methylsulfonyl]-1-oxopropan-2-yl]-3,4-difluorobenzamide.
| Compound Name | N-[(2R)-1-[cyano(methyl)amino]-3-[[2-(difluoromethoxy)phenyl]methylsulfonyl]-1-oxopropan-2-yl]-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 24885867 |
| Molecular Formula | C20H17F4N3O5S |
| Molecular Weight | 487.43 g/mol |
| Exact Mass | 487.08 |
| IUPAC Name | N-[(2R)-1-[cyano(methyl)amino]-3-[[2-(difluoromethoxy)phenyl]methylsulfonyl]-1-oxopropan-2-yl]-3,4-difluorobenzamide |
| SMILES | CN(C#N)C(=O)[C@H](CS(=O)(=O)Cc1ccccc1OC(F)F)NC(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C20H17F4N3O5S/c1-27(11-25)19(29)16(26-18(28)12-6-7-14(21)15(22)8-12)10-33(30,31)9-13-4-2-3-5-17(13)32-20(23)24/h2-8,16,20H,9-10H2,1H3,(H,26,28)/t16-/m0/s1 |
| InChIKey | SRBIDIBOYCPZFV-INIZCTEOSA-N |
| XLogP | 2.22 |
| TPSA | 116.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.43 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|