C19H23F2N3O6S — CID 22054004
N-(cyanomethyl)-2-[[2-(difluoromethoxy)phenyl]methylsulfonylmethyl]-4-morpholin-4-yl-4-oxobutanamide (PubChem CID 22054004) has the molecular formula C19H23F2N3O6S and a molecular weight of 459.47 g/mol. Its IUPAC name is N-(cyanomethyl)-2-[[2-(difluoromethoxy)phenyl]methylsulfonylmethyl]-4-morpholin-4-yl-4-oxobutanamide.
| Compound Name | N-(cyanomethyl)-2-[[2-(difluoromethoxy)phenyl]methylsulfonylmethyl]-4-morpholin-4-yl-4-oxobutanamide |
|---|---|
| PubChem CID | 22054004 |
| Molecular Formula | C19H23F2N3O6S |
| Molecular Weight | 459.47 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | N-(cyanomethyl)-2-[[2-(difluoromethoxy)phenyl]methylsulfonylmethyl]-4-morpholin-4-yl-4-oxobutanamide |
| SMILES | N#CCNC(=O)C(CC(=O)N1CCOCC1)CS(=O)(=O)Cc1ccccc1OC(F)F |
| InChI | InChI=1S/C19H23F2N3O6S/c20-19(21)30-16-4-2-1-3-14(16)12-31(27,28)13-15(18(26)23-6-5-22)11-17(25)24-7-9-29-10-8-24/h1-4,15,19H,6-13H2,(H,23,26) |
| InChIKey | CFCQPJANARRACU-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 125.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.47 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|