C25H39N3O7S — CID 142846997
2-(benzylsulfonylmethyl)-N-[3-(diethylamino)-2,3-dioxopropyl]-4-morpholin-4-yl-4-oxobutanamide;ethane (PubChem CID 142846997) has the molecular formula C25H39N3O7S and a molecular weight of 525.67 g/mol. Its IUPAC name is 2-(benzylsulfonylmethyl)-N-[3-(diethylamino)-2,3-dioxopropyl]-4-morpholin-4-yl-4-oxobutanamide;ethane.
| Compound Name | 2-(benzylsulfonylmethyl)-N-[3-(diethylamino)-2,3-dioxopropyl]-4-morpholin-4-yl-4-oxobutanamide;ethane |
|---|---|
| PubChem CID | 142846997 |
| Molecular Formula | C25H39N3O7S |
| Molecular Weight | 525.67 g/mol |
| Exact Mass | 525.25 |
| IUPAC Name | 2-(benzylsulfonylmethyl)-N-[3-(diethylamino)-2,3-dioxopropyl]-4-morpholin-4-yl-4-oxobutanamide;ethane |
| SMILES | CC.CCN(CC)C(=O)C(=O)CNC(=O)C(CC(=O)N1CCOCC1)CS(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C23H33N3O7S.C2H6/c1-3-25(4-2)23(30)20(27)15-24-22(29)19(14-21(28)26-10-12-33-13-11-26)17-34(31,32)16-18-8-6-5-7-9-18;1-2/h5-9,19H,3-4,10-17H2,1-2H3,(H,24,29);1-2H3 |
| InChIKey | MGECUAQRYAEAQZ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 130.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.67 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|