C13H23NO6S — CID 11565984
2-(2-methylpropylsulfonylmethyl)-4-morpholin-4-yl-4-oxobutanoic acid (PubChem CID 11565984) has the molecular formula C13H23NO6S and a molecular weight of 321.40 g/mol. Its IUPAC name is 2-(2-methylpropylsulfonylmethyl)-4-morpholin-4-yl-4-oxobutanoic acid.
| Compound Name | 2-(2-methylpropylsulfonylmethyl)-4-morpholin-4-yl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 11565984 |
| Molecular Formula | C13H23NO6S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | 2-(2-methylpropylsulfonylmethyl)-4-morpholin-4-yl-4-oxobutanoic acid |
| SMILES | CC(C)CS(=O)(=O)CC(CC(=O)N1CCOCC1)C(=O)O |
| InChI | InChI=1S/C13H23NO6S/c1-10(2)8-21(18,19)9-11(13(16)17)7-12(15)14-3-5-20-6-4-14/h10-11H,3-9H2,1-2H3,(H,16,17) |
| InChIKey | UXJURLPTFVXBMU-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |