C29H36N2O7S — CID 10281040
2-(benzylsulfonylmethyl)-N-(1,2-dioxo-1-phenylheptan-3-yl)-4-morpholin-4-yl-4-oxobutanamide (PubChem CID 10281040) has the molecular formula C29H36N2O7S and a molecular weight of 556.68 g/mol. Its IUPAC name is 2-(benzylsulfonylmethyl)-N-(1,2-dioxo-1-phenylheptan-3-yl)-4-morpholin-4-yl-4-oxobutanamide.
| Compound Name | 2-(benzylsulfonylmethyl)-N-(1,2-dioxo-1-phenylheptan-3-yl)-4-morpholin-4-yl-4-oxobutanamide |
|---|---|
| PubChem CID | 10281040 |
| Molecular Formula | C29H36N2O7S |
| Molecular Weight | 556.68 g/mol |
| Exact Mass | 556.22 |
| IUPAC Name | 2-(benzylsulfonylmethyl)-N-(1,2-dioxo-1-phenylheptan-3-yl)-4-morpholin-4-yl-4-oxobutanamide |
| SMILES | CCCCC(NC(=O)C(CC(=O)N1CCOCC1)CS(=O)(=O)Cc1ccccc1)C(=O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C29H36N2O7S/c1-2-3-14-25(28(34)27(33)23-12-8-5-9-13-23)30-29(35)24(19-26(32)31-15-17-38-18-16-31)21-39(36,37)20-22-10-6-4-7-11-22/h4-13,24-25H,2-3,14-21H2,1H3,(H,30,35) |
| InChIKey | WRKHIFDHFRXLAU-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 126.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.68 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|