C20H26F2N2O7S — CID 10277225
3-[[2-(difluoromethoxy)phenyl]methylsulfonyl]-N-(1-morpholin-4-yl-1,2-dioxopentan-3-yl)propanamide (PubChem CID 10277225) has the molecular formula C20H26F2N2O7S and a molecular weight of 476.50 g/mol. Its IUPAC name is 3-[[2-(difluoromethoxy)phenyl]methylsulfonyl]-N-(1-morpholin-4-yl-1,2-dioxopentan-3-yl)propanamide.
| Compound Name | 3-[[2-(difluoromethoxy)phenyl]methylsulfonyl]-N-(1-morpholin-4-yl-1,2-dioxopentan-3-yl)propanamide |
|---|---|
| PubChem CID | 10277225 |
| Molecular Formula | C20H26F2N2O7S |
| Molecular Weight | 476.50 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | 3-[[2-(difluoromethoxy)phenyl]methylsulfonyl]-N-(1-morpholin-4-yl-1,2-dioxopentan-3-yl)propanamide |
| SMILES | CCC(NC(=O)CCS(=O)(=O)Cc1ccccc1OC(F)F)C(=O)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C20H26F2N2O7S/c1-2-15(18(26)19(27)24-8-10-30-11-9-24)23-17(25)7-12-32(28,29)13-14-5-3-4-6-16(14)31-20(21)22/h3-6,15,20H,2,7-13H2,1H3,(H,23,25) |
| InChIKey | NPXHGTPNKHDDMZ-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.50 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|