C19H20F2N2O5S — CID 30955346
2-(difluoromethoxy)-N-[(2-morpholin-4-ylsulfonylphenyl)methyl]benzamide (PubChem CID 30955346) has the molecular formula C19H20F2N2O5S and a molecular weight of 426.44 g/mol. Its IUPAC name is 2-(difluoromethoxy)-N-[(2-morpholin-4-ylsulfonylphenyl)methyl]benzamide.
| Compound Name | 2-(difluoromethoxy)-N-[(2-morpholin-4-ylsulfonylphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 30955346 |
| Molecular Formula | C19H20F2N2O5S |
| Molecular Weight | 426.44 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | 2-(difluoromethoxy)-N-[(2-morpholin-4-ylsulfonylphenyl)methyl]benzamide |
| SMILES | O=C(NCc1ccccc1S(=O)(=O)N1CCOCC1)c1ccccc1OC(F)F |
| InChI | InChI=1S/C19H20F2N2O5S/c20-19(21)28-16-7-3-2-6-15(16)18(24)22-13-14-5-1-4-8-17(14)29(25,26)23-9-11-27-12-10-23/h1-8,19H,9-13H2,(H,22,24) |
| InChIKey | UDQSIMMQCNFLDN-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.44 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |