C23H28N2O6S — CID 30797106
N-[(2-morpholin-4-ylsulfonylphenyl)methyl]-2-[[(2R)-oxolan-2-yl]methoxy]benzamide (PubChem CID 30797106) has the molecular formula C23H28N2O6S and a molecular weight of 460.55 g/mol. Its IUPAC name is N-[(2-morpholin-4-ylsulfonylphenyl)methyl]-2-[[(2R)-oxolan-2-yl]methoxy]benzamide.
| Compound Name | N-[(2-morpholin-4-ylsulfonylphenyl)methyl]-2-[[(2R)-oxolan-2-yl]methoxy]benzamide |
|---|---|
| PubChem CID | 30797106 |
| Molecular Formula | C23H28N2O6S |
| Molecular Weight | 460.55 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | N-[(2-morpholin-4-ylsulfonylphenyl)methyl]-2-[[(2R)-oxolan-2-yl]methoxy]benzamide |
| SMILES | O=C(NCc1ccccc1S(=O)(=O)N1CCOCC1)c1ccccc1OC[C@H]1CCCO1 |
| InChI | InChI=1S/C23H28N2O6S/c26-23(20-8-2-3-9-21(20)31-17-19-7-5-13-30-19)24-16-18-6-1-4-10-22(18)32(27,28)25-11-14-29-15-12-25/h1-4,6,8-10,19H,5,7,11-17H2,(H,24,26)/t19-/m1/s1 |
| InChIKey | SEERABOKSMSLMX-LJQANCHMSA-N |
| XLogP | 2.20 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.55 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |