C24H30N2O5S — CID 43042819
N-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]-2-(oxolan-2-ylmethoxy)benzamide (PubChem CID 43042819) has the molecular formula C24H30N2O5S and a molecular weight of 458.58 g/mol. Its IUPAC name is N-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]-2-(oxolan-2-ylmethoxy)benzamide.
| Compound Name | N-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]-2-(oxolan-2-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 43042819 |
| Molecular Formula | C24H30N2O5S |
| Molecular Weight | 458.58 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | N-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]-2-(oxolan-2-ylmethoxy)benzamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(NC(=O)c3ccccc3OCC3CCCO3)CC2)cc1 |
| InChI | InChI=1S/C24H30N2O5S/c1-18-8-10-21(11-9-18)32(28,29)26-14-12-19(13-15-26)25-24(27)22-6-2-3-7-23(22)31-17-20-5-4-16-30-20/h2-3,6-11,19-20H,4-5,12-17H2,1H3,(H,25,27) |
| InChIKey | IEKMHWSTNMRNIE-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.58 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |