C26H27F2N3O2 — CID 39172415
2-(difluoromethoxy)-N-[[2-[(4-phenylpiperazin-1-yl)methyl]phenyl]methyl]benzamide (PubChem CID 39172415) has the molecular formula C26H27F2N3O2 and a molecular weight of 451.52 g/mol. Its IUPAC name is 2-(difluoromethoxy)-N-[[2-[(4-phenylpiperazin-1-yl)methyl]phenyl]methyl]benzamide.
| Compound Name | 2-(difluoromethoxy)-N-[[2-[(4-phenylpiperazin-1-yl)methyl]phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 39172415 |
| Molecular Formula | C26H27F2N3O2 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | 2-(difluoromethoxy)-N-[[2-[(4-phenylpiperazin-1-yl)methyl]phenyl]methyl]benzamide |
| SMILES | O=C(NCc1ccccc1CN1CCN(c2ccccc2)CC1)c1ccccc1OC(F)F |
| InChI | InChI=1S/C26H27F2N3O2/c27-26(28)33-24-13-7-6-12-23(24)25(32)29-18-20-8-4-5-9-21(20)19-30-14-16-31(17-15-30)22-10-2-1-3-11-22/h1-13,26H,14-19H2,(H,29,32) |
| InChIKey | ISQPLUSTEXLUNI-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |