C27H29FN4O2 — CID 60567676
5-acetamido-2-fluoro-N-[[2-[(4-phenylpiperazin-1-yl)methyl]phenyl]methyl]benzamide (PubChem CID 60567676) has the molecular formula C27H29FN4O2 and a molecular weight of 460.55 g/mol. Its IUPAC name is 5-acetamido-2-fluoro-N-[[2-[(4-phenylpiperazin-1-yl)methyl]phenyl]methyl]benzamide.
| Compound Name | 5-acetamido-2-fluoro-N-[[2-[(4-phenylpiperazin-1-yl)methyl]phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 60567676 |
| Molecular Formula | C27H29FN4O2 |
| Molecular Weight | 460.55 g/mol |
| Exact Mass | 460.23 |
| IUPAC Name | 5-acetamido-2-fluoro-N-[[2-[(4-phenylpiperazin-1-yl)methyl]phenyl]methyl]benzamide |
| SMILES | CC(=O)Nc1ccc(F)c(C(=O)NCc2ccccc2CN2CCN(c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C27H29FN4O2/c1-20(33)30-23-11-12-26(28)25(17-23)27(34)29-18-21-7-5-6-8-22(21)19-31-13-15-32(16-14-31)24-9-3-2-4-10-24/h2-12,17H,13-16,18-19H2,1H3,(H,29,34)(H,30,33) |
| InChIKey | RCFNNSCRQJHROK-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.55 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |