C15H22F2N2O2 — CID 43675802
N-[[2-(difluoromethoxy)phenyl]methyl]-1-morpholin-4-ylpropan-2-amine (PubChem CID 43675802) has the molecular formula C15H22F2N2O2 and a molecular weight of 300.35 g/mol. Its IUPAC name is N-[[2-(difluoromethoxy)phenyl]methyl]-1-morpholin-4-ylpropan-2-amine.
| Compound Name | N-[[2-(difluoromethoxy)phenyl]methyl]-1-morpholin-4-ylpropan-2-amine |
|---|---|
| PubChem CID | 43675802 |
| Molecular Formula | C15H22F2N2O2 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | N-[[2-(difluoromethoxy)phenyl]methyl]-1-morpholin-4-ylpropan-2-amine |
| SMILES | CC(CN1CCOCC1)NCc1ccccc1OC(F)F |
| InChI | InChI=1S/C15H22F2N2O2/c1-12(11-19-6-8-20-9-7-19)18-10-13-4-2-3-5-14(13)21-15(16)17/h2-5,12,15,18H,6-11H2,1H3 |
| InChIKey | JRCLLBLXNUEFHY-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |