C13H19F2NO3S — CID 115626137
N-[[2-(difluoromethoxy)phenyl]methyl]-1-ethylsulfonylpropan-2-amine (PubChem CID 115626137) has the molecular formula C13H19F2NO3S and a molecular weight of 307.36 g/mol. Its IUPAC name is N-[[2-(difluoromethoxy)phenyl]methyl]-1-ethylsulfonylpropan-2-amine.
| Compound Name | N-[[2-(difluoromethoxy)phenyl]methyl]-1-ethylsulfonylpropan-2-amine |
|---|---|
| PubChem CID | 115626137 |
| Molecular Formula | C13H19F2NO3S |
| Molecular Weight | 307.36 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | N-[[2-(difluoromethoxy)phenyl]methyl]-1-ethylsulfonylpropan-2-amine |
| SMILES | CCS(=O)(=O)CC(C)NCc1ccccc1OC(F)F |
| InChI | InChI=1S/C13H19F2NO3S/c1-3-20(17,18)9-10(2)16-8-11-6-4-5-7-12(11)19-13(14)15/h4-7,10,13,16H,3,8-9H2,1-2H3 |
| InChIKey | BPPCHBBALWWMQU-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.36 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |