C14H21F2NO2 — CID 61247131
2-[[2-(difluoromethoxy)phenyl]methylamino]-4-methylpentan-1-ol (PubChem CID 61247131) has the molecular formula C14H21F2NO2 and a molecular weight of 273.32 g/mol. Its IUPAC name is 2-[[2-(difluoromethoxy)phenyl]methylamino]-4-methylpentan-1-ol.
| Compound Name | 2-[[2-(difluoromethoxy)phenyl]methylamino]-4-methylpentan-1-ol |
|---|---|
| PubChem CID | 61247131 |
| Molecular Formula | C14H21F2NO2 |
| Molecular Weight | 273.32 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 2-[[2-(difluoromethoxy)phenyl]methylamino]-4-methylpentan-1-ol |
| SMILES | CC(C)CC(CO)NCc1ccccc1OC(F)F |
| InChI | InChI=1S/C14H21F2NO2/c1-10(2)7-12(9-18)17-8-11-5-3-4-6-13(11)19-14(15)16/h3-6,10,12,14,17-18H,7-9H2,1-2H3 |
| InChIKey | QKOLWGPNZZELHH-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.32 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |