C14H23ClNO2- — CID 53351262
2-[(2-propan-2-yloxyphenyl)methylamino]butan-1-ol chloride (PubChem CID 53351262) has the molecular formula C14H23ClNO2- and a molecular weight of 272.80 g/mol. Its IUPAC name is 2-[(2-propan-2-yloxyphenyl)methylamino]butan-1-ol chloride.
| Compound Name | 2-[(2-propan-2-yloxyphenyl)methylamino]butan-1-ol chloride |
|---|---|
| PubChem CID | 53351262 |
| Molecular Formula | C14H23ClNO2- |
| Molecular Weight | 272.80 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | 2-[(2-propan-2-yloxyphenyl)methylamino]butan-1-ol chloride |
| SMILES | CCC(CO)NCc1ccccc1OC(C)C.[Cl-] |
| InChI | InChI=1S/C14H23NO2.ClH/c1-4-13(10-16)15-9-12-7-5-6-8-14(12)17-11(2)3;/h5-8,11,13,15-16H,4,9-10H2,1-3H3;1H/p-1 |
| InChIKey | FOWXYXBIPVVXIO-UHFFFAOYSA-M |
| XLogP | -0.66 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.80 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |