C16H24F2N2O3 — CID 103387484
tert-butyl N-[2-[[2-(difluoromethoxy)phenyl]methylamino]propyl]carbamate (PubChem CID 103387484) has the molecular formula C16H24F2N2O3 and a molecular weight of 330.38 g/mol. Its IUPAC name is tert-butyl N-[2-[[2-(difluoromethoxy)phenyl]methylamino]propyl]carbamate.
| Compound Name | tert-butyl N-[2-[[2-(difluoromethoxy)phenyl]methylamino]propyl]carbamate |
|---|---|
| PubChem CID | 103387484 |
| Molecular Formula | C16H24F2N2O3 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | tert-butyl N-[2-[[2-(difluoromethoxy)phenyl]methylamino]propyl]carbamate |
| SMILES | CC(CNC(=O)OC(C)(C)C)NCc1ccccc1OC(F)F |
| InChI | InChI=1S/C16H24F2N2O3/c1-11(9-20-15(21)23-16(2,3)4)19-10-12-7-5-6-8-13(12)22-14(17)18/h5-8,11,14,19H,9-10H2,1-4H3,(H,20,21) |
| InChIKey | ZHTOSNAMFZBHJQ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |