C19H19F2N5O5S — CID 91568361
(2R)-2-[amino(pyridine-3-carbonyl)amino]-N-cyano-3-[[2-(difluoromethoxy)phenyl]methylsulfonyl]-N-methylpropanamide (PubChem CID 91568361) has the molecular formula C19H19F2N5O5S and a molecular weight of 467.45 g/mol. Its IUPAC name is (2R)-2-[amino(pyridine-3-carbonyl)amino]-N-cyano-3-[[2-(difluoromethoxy)phenyl]methylsulfonyl]-N-methylpropanamide.
| Compound Name | (2R)-2-[amino(pyridine-3-carbonyl)amino]-N-cyano-3-[[2-(difluoromethoxy)phenyl]methylsulfonyl]-N-methylpropanamide |
|---|---|
| PubChem CID | 91568361 |
| Molecular Formula | C19H19F2N5O5S |
| Molecular Weight | 467.45 g/mol |
| Exact Mass | 467.11 |
| IUPAC Name | (2R)-2-[amino(pyridine-3-carbonyl)amino]-N-cyano-3-[[2-(difluoromethoxy)phenyl]methylsulfonyl]-N-methylpropanamide |
| SMILES | CN(C#N)C(=O)[C@H](CS(=O)(=O)Cc1ccccc1OC(F)F)N(N)C(=O)c1cccnc1 |
| InChI | InChI=1S/C19H19F2N5O5S/c1-25(12-22)18(28)15(26(23)17(27)13-6-4-8-24-9-13)11-32(29,30)10-14-5-2-3-7-16(14)31-19(20)21/h2-9,15,19H,10-11,23H2,1H3/t15-/m0/s1 |
| InChIKey | ZDSMWYMJPVXOTN-HNNXBMFYSA-N |
| XLogP | 0.92 |
| TPSA | 146.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.45 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|