C22H18ClF2N3O5S2 — CID 24886814
3-chloro-N-[(2R)-1-[cyano(methyl)amino]-3-[[2-(difluoromethoxy)phenyl]methylsulfonyl]-1-oxopropan-2-yl]-1-benzothiophene-2-carboxamide (PubChem CID 24886814) has the molecular formula C22H18ClF2N3O5S2 and a molecular weight of 541.99 g/mol. Its IUPAC name is 3-chloro-N-[(2R)-1-[cyano(methyl)amino]-3-[[2-(difluoromethoxy)phenyl]methylsulfonyl]-1-oxopropan-2-yl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[(2R)-1-[cyano(methyl)amino]-3-[[2-(difluoromethoxy)phenyl]methylsulfonyl]-1-oxopropan-2-yl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 24886814 |
| Molecular Formula | C22H18ClF2N3O5S2 |
| Molecular Weight | 541.99 g/mol |
| Exact Mass | 541.03 |
| IUPAC Name | 3-chloro-N-[(2R)-1-[cyano(methyl)amino]-3-[[2-(difluoromethoxy)phenyl]methylsulfonyl]-1-oxopropan-2-yl]-1-benzothiophene-2-carboxamide |
| SMILES | CN(C#N)C(=O)[C@H](CS(=O)(=O)Cc1ccccc1OC(F)F)NC(=O)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C22H18ClF2N3O5S2/c1-28(12-26)21(30)15(27-20(29)19-18(23)14-7-3-5-9-17(14)34-19)11-35(31,32)10-13-6-2-4-8-16(13)33-22(24)25/h2-9,15,22H,10-11H2,1H3,(H,27,29)/t15-/m0/s1 |
| InChIKey | YSKIKBIWIKUZJW-HNNXBMFYSA-N |
| XLogP | 3.81 |
| TPSA | 116.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.99 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|