C19H21F2NO5S — CID 46544000
[2-(difluoromethoxy)phenyl]methyl 3-[methyl(propan-2-yl)sulfamoyl]benzoate (PubChem CID 46544000) has the molecular formula C19H21F2NO5S and a molecular weight of 413.44 g/mol. Its IUPAC name is [2-(difluoromethoxy)phenyl]methyl 3-[methyl(propan-2-yl)sulfamoyl]benzoate.
| Compound Name | [2-(difluoromethoxy)phenyl]methyl 3-[methyl(propan-2-yl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 46544000 |
| Molecular Formula | C19H21F2NO5S |
| Molecular Weight | 413.44 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | [2-(difluoromethoxy)phenyl]methyl 3-[methyl(propan-2-yl)sulfamoyl]benzoate |
| SMILES | CC(C)N(C)S(=O)(=O)c1cccc(C(=O)OCc2ccccc2OC(F)F)c1 |
| InChI | InChI=1S/C19H21F2NO5S/c1-13(2)22(3)28(24,25)16-9-6-8-14(11-16)18(23)26-12-15-7-4-5-10-17(15)27-19(20)21/h4-11,13,19H,12H2,1-3H3 |
| InChIKey | FAYBZEFEJDZZEI-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.44 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |