C18H22F2N2O5S — CID 46544901
[2-(difluoromethoxy)phenyl]methyl 4-(diethylsulfamoyl)-1-methylpyrrole-2-carboxylate (PubChem CID 46544901) has the molecular formula C18H22F2N2O5S and a molecular weight of 416.45 g/mol. Its IUPAC name is [2-(difluoromethoxy)phenyl]methyl 4-(diethylsulfamoyl)-1-methylpyrrole-2-carboxylate.
| Compound Name | [2-(difluoromethoxy)phenyl]methyl 4-(diethylsulfamoyl)-1-methylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 46544901 |
| Molecular Formula | C18H22F2N2O5S |
| Molecular Weight | 416.45 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | [2-(difluoromethoxy)phenyl]methyl 4-(diethylsulfamoyl)-1-methylpyrrole-2-carboxylate |
| SMILES | CCN(CC)S(=O)(=O)c1cc(C(=O)OCc2ccccc2OC(F)F)n(C)c1 |
| InChI | InChI=1S/C18H22F2N2O5S/c1-4-22(5-2)28(24,25)14-10-15(21(3)11-14)17(23)26-12-13-8-6-7-9-16(13)27-18(19)20/h6-11,18H,4-5,12H2,1-3H3 |
| InChIKey | LDVPAFYZYNQJSC-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 77.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.45 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |