C20H24N4O5S — CID 46648720
[2-[N-(cyanomethyl)anilino]-2-oxoethyl] 4-(diethylsulfamoyl)-1-methylpyrrole-2-carboxylate (PubChem CID 46648720) has the molecular formula C20H24N4O5S and a molecular weight of 432.50 g/mol. Its IUPAC name is [2-[N-(cyanomethyl)anilino]-2-oxoethyl] 4-(diethylsulfamoyl)-1-methylpyrrole-2-carboxylate.
| Compound Name | [2-[N-(cyanomethyl)anilino]-2-oxoethyl] 4-(diethylsulfamoyl)-1-methylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 46648720 |
| Molecular Formula | C20H24N4O5S |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | [2-[N-(cyanomethyl)anilino]-2-oxoethyl] 4-(diethylsulfamoyl)-1-methylpyrrole-2-carboxylate |
| SMILES | CCN(CC)S(=O)(=O)c1cc(C(=O)OCC(=O)N(CC#N)c2ccccc2)n(C)c1 |
| InChI | InChI=1S/C20H24N4O5S/c1-4-23(5-2)30(27,28)17-13-18(22(3)14-17)20(26)29-15-19(25)24(12-11-21)16-9-7-6-8-10-16/h6-10,13-14H,4-5,12,15H2,1-3H3 |
| InChIKey | HTUREZIXFSJEKM-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 112.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|