C22H32N4O5S — CID 43034801
[2-[[4-(dimethylamino)phenyl]methyl-methylamino]-2-oxoethyl] 4-(diethylsulfamoyl)-1-methylpyrrole-2-carboxylate (PubChem CID 43034801) has the molecular formula C22H32N4O5S and a molecular weight of 464.59 g/mol. Its IUPAC name is [2-[[4-(dimethylamino)phenyl]methyl-methylamino]-2-oxoethyl] 4-(diethylsulfamoyl)-1-methylpyrrole-2-carboxylate.
| Compound Name | [2-[[4-(dimethylamino)phenyl]methyl-methylamino]-2-oxoethyl] 4-(diethylsulfamoyl)-1-methylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 43034801 |
| Molecular Formula | C22H32N4O5S |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | [2-[[4-(dimethylamino)phenyl]methyl-methylamino]-2-oxoethyl] 4-(diethylsulfamoyl)-1-methylpyrrole-2-carboxylate |
| SMILES | CCN(CC)S(=O)(=O)c1cc(C(=O)OCC(=O)N(C)Cc2ccc(N(C)C)cc2)n(C)c1 |
| InChI | InChI=1S/C22H32N4O5S/c1-7-26(8-2)32(29,30)19-13-20(24(5)15-19)22(28)31-16-21(27)25(6)14-17-9-11-18(12-10-17)23(3)4/h9-13,15H,7-8,14,16H2,1-6H3 |
| InChIKey | QXEYIHCWKBYKMP-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 92.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|