C18H21FN4O7S — CID 27937906
[2-(2-fluoro-5-nitroanilino)-2-oxoethyl] 4-(diethylsulfamoyl)-1-methylpyrrole-2-carboxylate (PubChem CID 27937906) has the molecular formula C18H21FN4O7S and a molecular weight of 456.45 g/mol. Its IUPAC name is [2-(2-fluoro-5-nitroanilino)-2-oxoethyl] 4-(diethylsulfamoyl)-1-methylpyrrole-2-carboxylate.
| Compound Name | [2-(2-fluoro-5-nitroanilino)-2-oxoethyl] 4-(diethylsulfamoyl)-1-methylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 27937906 |
| Molecular Formula | C18H21FN4O7S |
| Molecular Weight | 456.45 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | [2-(2-fluoro-5-nitroanilino)-2-oxoethyl] 4-(diethylsulfamoyl)-1-methylpyrrole-2-carboxylate |
| SMILES | CCN(CC)S(=O)(=O)c1cc(C(=O)OCC(=O)Nc2cc([N+](=O)[O-])ccc2F)n(C)c1 |
| InChI | InChI=1S/C18H21FN4O7S/c1-4-22(5-2)31(28,29)13-9-16(21(3)10-13)18(25)30-11-17(24)20-15-8-12(23(26)27)6-7-14(15)19/h6-10H,4-5,11H2,1-3H3,(H,20,24) |
| InChIKey | KVFGISJAPQKRIX-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 140.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.45 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|