C21H25NO5S — CID 7753639
[2-(4-ethylphenyl)-2-oxoethyl] 3-[methyl(propan-2-yl)sulfamoyl]benzoate (PubChem CID 7753639) has the molecular formula C21H25NO5S and a molecular weight of 403.50 g/mol. Its IUPAC name is [2-(4-ethylphenyl)-2-oxoethyl] 3-[methyl(propan-2-yl)sulfamoyl]benzoate.
| Compound Name | [2-(4-ethylphenyl)-2-oxoethyl] 3-[methyl(propan-2-yl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 7753639 |
| Molecular Formula | C21H25NO5S |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | [2-(4-ethylphenyl)-2-oxoethyl] 3-[methyl(propan-2-yl)sulfamoyl]benzoate |
| SMILES | CCc1ccc(C(=O)COC(=O)c2cccc(S(=O)(=O)N(C)C(C)C)c2)cc1 |
| InChI | InChI=1S/C21H25NO5S/c1-5-16-9-11-17(12-10-16)20(23)14-27-21(24)18-7-6-8-19(13-18)28(25,26)22(4)15(2)3/h6-13,15H,5,14H2,1-4H3 |
| InChIKey | UWSHFOLIEQOGML-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |