C24H30N2O6S — CID 42978536
[2-[4-(3-methylbutanoylamino)phenyl]-2-oxoethyl] 3-[methyl(propan-2-yl)sulfamoyl]benzoate (PubChem CID 42978536) has the molecular formula C24H30N2O6S and a molecular weight of 474.58 g/mol. Its IUPAC name is [2-[4-(3-methylbutanoylamino)phenyl]-2-oxoethyl] 3-[methyl(propan-2-yl)sulfamoyl]benzoate.
| Compound Name | [2-[4-(3-methylbutanoylamino)phenyl]-2-oxoethyl] 3-[methyl(propan-2-yl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 42978536 |
| Molecular Formula | C24H30N2O6S |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | [2-[4-(3-methylbutanoylamino)phenyl]-2-oxoethyl] 3-[methyl(propan-2-yl)sulfamoyl]benzoate |
| SMILES | CC(C)CC(=O)Nc1ccc(C(=O)COC(=O)c2cccc(S(=O)(=O)N(C)C(C)C)c2)cc1 |
| InChI | InChI=1S/C24H30N2O6S/c1-16(2)13-23(28)25-20-11-9-18(10-12-20)22(27)15-32-24(29)19-7-6-8-21(14-19)33(30,31)26(5)17(3)4/h6-12,14,16-17H,13,15H2,1-5H3,(H,25,28) |
| InChIKey | KEQUIRRUCDVFCE-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |