C21H27NO6S — CID 7753630
2-(4-ethoxyphenoxy)ethyl 3-[methyl(propan-2-yl)sulfamoyl]benzoate (PubChem CID 7753630) has the molecular formula C21H27NO6S and a molecular weight of 421.52 g/mol. Its IUPAC name is 2-(4-ethoxyphenoxy)ethyl 3-[methyl(propan-2-yl)sulfamoyl]benzoate.
| Compound Name | 2-(4-ethoxyphenoxy)ethyl 3-[methyl(propan-2-yl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 7753630 |
| Molecular Formula | C21H27NO6S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | 2-(4-ethoxyphenoxy)ethyl 3-[methyl(propan-2-yl)sulfamoyl]benzoate |
| SMILES | CCOc1ccc(OCCOC(=O)c2cccc(S(=O)(=O)N(C)C(C)C)c2)cc1 |
| InChI | InChI=1S/C21H27NO6S/c1-5-26-18-9-11-19(12-10-18)27-13-14-28-21(23)17-7-6-8-20(15-17)29(24,25)22(4)16(2)3/h6-12,15-16H,5,13-14H2,1-4H3 |
| InChIKey | LQPPURYLQUKEIQ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|