C10H8F2N2O — CID 61119063
N-(1-cyanoethyl)-3,4-difluorobenzamide (PubChem CID 61119063) has the molecular formula C10H8F2N2O and a molecular weight of 210.18 g/mol. Its IUPAC name is N-(1-cyanoethyl)-3,4-difluorobenzamide.
| Compound Name | N-(1-cyanoethyl)-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 61119063 |
| Molecular Formula | C10H8F2N2O |
| Molecular Weight | 210.18 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | N-(1-cyanoethyl)-3,4-difluorobenzamide |
| SMILES | CC(C#N)NC(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C10H8F2N2O/c1-6(5-13)14-10(15)7-2-3-8(11)9(12)4-7/h2-4,6H,1H3,(H,14,15) |
| InChIKey | UDECMHLUWWQEFH-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.18 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |