C8H4F2N2O — CID 79195155
N-cyano-3,4-difluorobenzamide (PubChem CID 79195155) has the molecular formula C8H4F2N2O and a molecular weight of 182.13 g/mol. Its IUPAC name is N-cyano-3,4-difluorobenzamide.
| Compound Name | N-cyano-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 79195155 |
| Molecular Formula | C8H4F2N2O |
| Molecular Weight | 182.13 g/mol |
| Exact Mass | 182.03 |
| IUPAC Name | N-cyano-3,4-difluorobenzamide |
| SMILES | N#CNC(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C8H4F2N2O/c9-6-2-1-5(3-7(6)10)8(13)12-4-11/h1-3H,(H,12,13) |
| InChIKey | RSZSETYPECQAOD-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.13 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|