C8H3F3N2O — CID 79194594
N-cyano-3,4,5-trifluorobenzamide (PubChem CID 79194594) has the molecular formula C8H3F3N2O and a molecular weight of 200.12 g/mol. Its IUPAC name is N-cyano-3,4,5-trifluorobenzamide.
| Compound Name | N-cyano-3,4,5-trifluorobenzamide |
|---|---|
| PubChem CID | 79194594 |
| Molecular Formula | C8H3F3N2O |
| Molecular Weight | 200.12 g/mol |
| Exact Mass | 200.02 |
| IUPAC Name | N-cyano-3,4,5-trifluorobenzamide |
| SMILES | N#CNC(=O)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C8H3F3N2O/c9-5-1-4(8(14)13-3-12)2-6(10)7(5)11/h1-2H,(H,13,14) |
| InChIKey | KZOJEUDMCFFSBH-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.12 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|