C12H11F3N2O — CID 63185622
N-(1-cyanobutan-2-yl)-3,4,5-trifluorobenzamide (PubChem CID 63185622) has the molecular formula C12H11F3N2O and a molecular weight of 256.23 g/mol. Its IUPAC name is N-(1-cyanobutan-2-yl)-3,4,5-trifluorobenzamide.
| Compound Name | N-(1-cyanobutan-2-yl)-3,4,5-trifluorobenzamide |
|---|---|
| PubChem CID | 63185622 |
| Molecular Formula | C12H11F3N2O |
| Molecular Weight | 256.23 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | N-(1-cyanobutan-2-yl)-3,4,5-trifluorobenzamide |
| SMILES | CCC(CC#N)NC(=O)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C12H11F3N2O/c1-2-8(3-4-16)17-12(18)7-5-9(13)11(15)10(14)6-7/h5-6,8H,2-3H2,1H3,(H,17,18) |
| InChIKey | PNUWJJOFVZUNGJ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.23 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|