C11H11BrF3NO — CID 114307677
N-(1-bromobutan-2-yl)-3,4,5-trifluorobenzamide (PubChem CID 114307677) has the molecular formula C11H11BrF3NO and a molecular weight of 310.11 g/mol. Its IUPAC name is N-(1-bromobutan-2-yl)-3,4,5-trifluorobenzamide.
| Compound Name | N-(1-bromobutan-2-yl)-3,4,5-trifluorobenzamide |
|---|---|
| PubChem CID | 114307677 |
| Molecular Formula | C11H11BrF3NO |
| Molecular Weight | 310.11 g/mol |
| Exact Mass | 309.00 |
| IUPAC Name | N-(1-bromobutan-2-yl)-3,4,5-trifluorobenzamide |
| SMILES | CCC(CBr)NC(=O)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C11H11BrF3NO/c1-2-7(5-12)16-11(17)6-3-8(13)10(15)9(14)4-6/h3-4,7H,2,5H2,1H3,(H,16,17) |
| InChIKey | ZGMLNWBCULILMO-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.11 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|