C11H12BrCl2NO — CID 114307803
N-(1-bromobutan-2-yl)-3,5-dichlorobenzamide (PubChem CID 114307803) has the molecular formula C11H12BrCl2NO and a molecular weight of 325.03 g/mol. Its IUPAC name is N-(1-bromobutan-2-yl)-3,5-dichlorobenzamide.
| Compound Name | N-(1-bromobutan-2-yl)-3,5-dichlorobenzamide |
|---|---|
| PubChem CID | 114307803 |
| Molecular Formula | C11H12BrCl2NO |
| Molecular Weight | 325.03 g/mol |
| Exact Mass | 322.95 |
| IUPAC Name | N-(1-bromobutan-2-yl)-3,5-dichlorobenzamide |
| SMILES | CCC(CBr)NC(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C11H12BrCl2NO/c1-2-10(6-12)15-11(16)7-3-8(13)5-9(14)4-7/h3-5,10H,2,6H2,1H3,(H,15,16) |
| InChIKey | PKTAZKWOJJTNIU-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.03 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|