C13H17Cl2NO2 — CID 61245438
3,5-dichloro-N-(1-hydroxy-4-methylpentan-2-yl)benzamide (PubChem CID 61245438) has the molecular formula C13H17Cl2NO2 and a molecular weight of 290.19 g/mol. Its IUPAC name is 3,5-dichloro-N-(1-hydroxy-4-methylpentan-2-yl)benzamide.
| Compound Name | 3,5-dichloro-N-(1-hydroxy-4-methylpentan-2-yl)benzamide |
|---|---|
| PubChem CID | 61245438 |
| Molecular Formula | C13H17Cl2NO2 |
| Molecular Weight | 290.19 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | 3,5-dichloro-N-(1-hydroxy-4-methylpentan-2-yl)benzamide |
| SMILES | CC(C)CC(CO)NC(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C13H17Cl2NO2/c1-8(2)3-12(7-17)16-13(18)9-4-10(14)6-11(15)5-9/h4-6,8,12,17H,3,7H2,1-2H3,(H,16,18) |
| InChIKey | CESBBKPPCHEJDR-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.19 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |