C13H17BrClNO2 — CID 81295056
4-bromo-3-chloro-N-(1-hydroxy-4-methylpentan-2-yl)benzamide (PubChem CID 81295056) has the molecular formula C13H17BrClNO2 and a molecular weight of 334.64 g/mol. Its IUPAC name is 4-bromo-3-chloro-N-(1-hydroxy-4-methylpentan-2-yl)benzamide.
| Compound Name | 4-bromo-3-chloro-N-(1-hydroxy-4-methylpentan-2-yl)benzamide |
|---|---|
| PubChem CID | 81295056 |
| Molecular Formula | C13H17BrClNO2 |
| Molecular Weight | 334.64 g/mol |
| Exact Mass | 333.01 |
| IUPAC Name | 4-bromo-3-chloro-N-(1-hydroxy-4-methylpentan-2-yl)benzamide |
| SMILES | CC(C)CC(CO)NC(=O)c1ccc(Br)c(Cl)c1 |
| InChI | InChI=1S/C13H17BrClNO2/c1-8(2)5-10(7-17)16-13(18)9-3-4-11(14)12(15)6-9/h3-4,6,8,10,17H,5,7H2,1-2H3,(H,16,18) |
| InChIKey | OIYDSSTWOVTSTD-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.64 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |