C12H14BrClN2O2 — CID 124589162
N-[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]-4-bromo-3-chlorobenzamide (PubChem CID 124589162) has the molecular formula C12H14BrClN2O2 and a molecular weight of 333.61 g/mol. Its IUPAC name is N-[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]-4-bromo-3-chlorobenzamide.
| Compound Name | N-[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]-4-bromo-3-chlorobenzamide |
|---|---|
| PubChem CID | 124589162 |
| Molecular Formula | C12H14BrClN2O2 |
| Molecular Weight | 333.61 g/mol |
| Exact Mass | 331.99 |
| IUPAC Name | N-[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]-4-bromo-3-chlorobenzamide |
| SMILES | CC(C)[C@H](NC(=O)c1ccc(Br)c(Cl)c1)C(N)=O |
| InChI | InChI=1S/C12H14BrClN2O2/c1-6(2)10(11(15)17)16-12(18)7-3-4-8(13)9(14)5-7/h3-6,10H,1-2H3,(H2,15,17)(H,16,18)/t10-/m0/s1 |
| InChIKey | SOGNGJGOENBJHK-JTQLQIEISA-N |
| XLogP | 2.34 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.61 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |