C10H17N3O2 — CID 61245282
N-(1-hydroxy-4-methylpentan-2-yl)-1H-pyrazole-4-carboxamide (PubChem CID 61245282) has the molecular formula C10H17N3O2 and a molecular weight of 211.26 g/mol. Its IUPAC name is N-(1-hydroxy-4-methylpentan-2-yl)-1H-pyrazole-4-carboxamide.
| Compound Name | N-(1-hydroxy-4-methylpentan-2-yl)-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 61245282 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | N-(1-hydroxy-4-methylpentan-2-yl)-1H-pyrazole-4-carboxamide |
| SMILES | CC(C)CC(CO)NC(=O)c1cn[nH]c1 |
| InChI | InChI=1S/C10H17N3O2/c1-7(2)3-9(6-14)13-10(15)8-4-11-12-5-8/h4-5,7,9,14H,3,6H2,1-2H3,(H,11,12)(H,13,15) |
| InChIKey | GHYVQBMTMPFTFE-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |